C12H13N3OS — CID 121008642
1-(1,3-oxazol-2-yl)-3-(2-phenylethyl)thiourea (PubChem CID 121008642) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 1-(1,3-oxazol-2-yl)-3-(2-phenylethyl)thiourea.
| Compound Name | 1-(1,3-oxazol-2-yl)-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 121008642 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 1-(1,3-oxazol-2-yl)-3-(2-phenylethyl)thiourea |
| SMILES | S=C(NCCc1ccccc1)Nc1ncco1 |
| InChI | InChI=1S/C12H13N3OS/c17-12(15-11-13-8-9-16-11)14-7-6-10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H2,13,14,15,17) |
| InChIKey | SAGXLZFLWVVCMJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|