C17H16FN5O — CID 142372376
N-[(Z)-1-amino-3-(pyrimidin-5-ylamino)prop-2-enylidene]-1-(2-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 142372376) has the molecular formula C17H16FN5O and a molecular weight of 325.35 g/mol. Its IUPAC name is N-[(Z)-1-amino-3-(pyrimidin-5-ylamino)prop-2-enylidene]-1-(2-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[(Z)-1-amino-3-(pyrimidin-5-ylamino)prop-2-enylidene]-1-(2-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 142372376 |
| Molecular Formula | C17H16FN5O |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | N-[(Z)-1-amino-3-(pyrimidin-5-ylamino)prop-2-enylidene]-1-(2-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | NC(/C=C\Nc1cncnc1)=N\C(=O)C1(c2ccccc2F)CC1 |
| InChI | InChI=1S/C17H16FN5O/c18-14-4-2-1-3-13(14)17(6-7-17)16(24)23-15(19)5-8-22-12-9-20-11-21-10-12/h1-5,8-11,22H,6-7H2,(H2,19,23,24)/b8-5- |
| InChIKey | ZPRAZWWEEOPMKC-YVMONPNESA-N |
| XLogP | 2.16 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|