C16H30NO5P — CID 142375188
8-[2-methylidenebutanoyl(prop-2-enyl)amino]octyl dihydrogen phosphate (PubChem CID 142375188) has the molecular formula C16H30NO5P and a molecular weight of 347.39 g/mol. Its IUPAC name is 8-[2-methylidenebutanoyl(prop-2-enyl)amino]octyl dihydrogen phosphate.
| Compound Name | 8-[2-methylidenebutanoyl(prop-2-enyl)amino]octyl dihydrogen phosphate |
|---|---|
| PubChem CID | 142375188 |
| Molecular Formula | C16H30NO5P |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 8-[2-methylidenebutanoyl(prop-2-enyl)amino]octyl dihydrogen phosphate |
| SMILES | C=CCN(CCCCCCCCOP(=O)(O)O)C(=O)C(=C)CC |
| InChI | InChI=1S/C16H30NO5P/c1-4-12-17(16(18)15(3)5-2)13-10-8-6-7-9-11-14-22-23(19,20)21/h4H,1,3,5-14H2,2H3,(H2,19,20,21) |
| InChIKey | WHDSGDACIXGAEV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|