C11H20N2 — CID 142375473
(Z)-N-ethyl-2-methyl-3-methylidene-5-(methylideneamino)hex-4-en-1-amine (PubChem CID 142375473) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (Z)-N-ethyl-2-methyl-3-methylidene-5-(methylideneamino)hex-4-en-1-amine.
| Compound Name | (Z)-N-ethyl-2-methyl-3-methylidene-5-(methylideneamino)hex-4-en-1-amine |
|---|---|
| PubChem CID | 142375473 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (Z)-N-ethyl-2-methyl-3-methylidene-5-(methylideneamino)hex-4-en-1-amine |
| SMILES | C=N/C(C)=C\C(=C)C(C)CNCC |
| InChI | InChI=1S/C11H20N2/c1-6-13-8-10(3)9(2)7-11(4)12-5/h7,10,13H,2,5-6,8H2,1,3-4H3/b11-7- |
| InChIKey | HXFCITLPSOOVGG-XFFZJAGNSA-N |
| XLogP | 2.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|