C24H30N4O2 — CID 142375795
benzonitrile;(5S)-5-benzyl-2-butyl-N,3-dimethyl-4-oxoimidazolidine-1-carboxamide (PubChem CID 142375795) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is benzonitrile;(5S)-5-benzyl-2-butyl-N,3-dimethyl-4-oxoimidazolidine-1-carboxamide.
| Compound Name | benzonitrile;(5S)-5-benzyl-2-butyl-N,3-dimethyl-4-oxoimidazolidine-1-carboxamide |
|---|---|
| PubChem CID | 142375795 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | benzonitrile;(5S)-5-benzyl-2-butyl-N,3-dimethyl-4-oxoimidazolidine-1-carboxamide |
| SMILES | CCCCC1N(C)C(=O)[C@H](Cc2ccccc2)N1C(=O)NC.N#Cc1ccccc1 |
| InChI | InChI=1S/C17H25N3O2.C7H5N/c1-4-5-11-15-19(3)16(21)14(20(15)17(22)18-2)12-13-9-7-6-8-10-13;8-6-7-4-2-1-3-5-7/h6-10,14-15H,4-5,11-12H2,1-3H3,(H,18,22);1-5H/t14-,15?;/m0./s1 |
| InChIKey | LOZFGCMPSJXLGI-QDVCFFRGSA-N |
| XLogP | 3.79 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |