C29H38N3O4S2 — CID 142376189
CID 142376189 (PubChem CID 142376189) has the molecular formula C29H38N3O4S2 and a molecular weight of 556.77 g/mol.
| Compound Name | CID 142376189 |
|---|---|
| PubChem CID | 142376189 |
| Molecular Formula | C29H38N3O4S2 |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | — |
| SMILES | CCN/C=C(\N)CC[C@@H](c1cc(CN2C[C@@H](C)Oc3ccccc3S2(=O)=O)c(C)s1)C(C)(C)C(=O)C1=C[CH]1 |
| InChI | InChI=1S/C29H38N3O4S2/c1-6-31-16-23(30)13-14-24(29(4,5)28(33)21-11-12-21)26-15-22(20(3)37-26)18-32-17-19(2)36-25-9-7-8-10-27(25)38(32,34)35/h7-12,15-16,19,24,31H,6,13-14,17-18,30H2,1-5H3/b23-16-/t19-,24+/m1/s1 |
| InChIKey | SOYGVVASIZWWNX-ULCPDLLOSA-N |
| XLogP | 5.04 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |