C14H20F2O — CID 142377058
[(3Z)-3,4-difluoro-5-methylhexa-1,3,5-trien-2-yl]oxymethylcyclohexane (PubChem CID 142377058) has the molecular formula C14H20F2O and a molecular weight of 242.31 g/mol. Its IUPAC name is [(3Z)-3,4-difluoro-5-methylhexa-1,3,5-trien-2-yl]oxymethylcyclohexane.
| Compound Name | [(3Z)-3,4-difluoro-5-methylhexa-1,3,5-trien-2-yl]oxymethylcyclohexane |
|---|---|
| PubChem CID | 142377058 |
| Molecular Formula | C14H20F2O |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | [(3Z)-3,4-difluoro-5-methylhexa-1,3,5-trien-2-yl]oxymethylcyclohexane |
| SMILES | C=C(C)/C(F)=C(/F)C(=C)OCC1CCCCC1 |
| InChI | InChI=1S/C14H20F2O/c1-10(2)13(15)14(16)11(3)17-9-12-7-5-4-6-8-12/h12H,1,3-9H2,2H3/b14-13- |
| InChIKey | LWYHPHDADUESGV-YPKPFQOOSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|