C17H26F2O2 — CID 143291823
1-[[(1Z,3E,6E)-7-ethoxy-1,2-difluorohepta-1,3,6-trien-3-yl]oxymethyl]-4-methylcyclohexane (PubChem CID 143291823) has the molecular formula C17H26F2O2 and a molecular weight of 300.39 g/mol. Its IUPAC name is 1-[[(1Z,3E,6E)-7-ethoxy-1,2-difluorohepta-1,3,6-trien-3-yl]oxymethyl]-4-methylcyclohexane.
| Compound Name | 1-[[(1Z,3E,6E)-7-ethoxy-1,2-difluorohepta-1,3,6-trien-3-yl]oxymethyl]-4-methylcyclohexane |
|---|---|
| PubChem CID | 143291823 |
| Molecular Formula | C17H26F2O2 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 1-[[(1Z,3E,6E)-7-ethoxy-1,2-difluorohepta-1,3,6-trien-3-yl]oxymethyl]-4-methylcyclohexane |
| SMILES | CCO/C=C/C/C=C(OCC1CCC(C)CC1)\C(F)=C\F |
| InChI | InChI=1S/C17H26F2O2/c1-3-20-11-5-4-6-17(16(19)12-18)21-13-15-9-7-14(2)8-10-15/h5-6,11-12,14-15H,3-4,7-10,13H2,1-2H3/b11-5+,16-12-,17-6+ |
| InChIKey | RCIDEYAZJHGLDT-JHRXLJOSSA-N |
| XLogP | 5.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|