C16H33NO — CID 142377248
2-tert-butyl-4-ethyl-N,N,2,4-tetramethylhexanamide (PubChem CID 142377248) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is 2-tert-butyl-4-ethyl-N,N,2,4-tetramethylhexanamide.
| Compound Name | 2-tert-butyl-4-ethyl-N,N,2,4-tetramethylhexanamide |
|---|---|
| PubChem CID | 142377248 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | 2-tert-butyl-4-ethyl-N,N,2,4-tetramethylhexanamide |
| SMILES | CCC(C)(CC)CC(C)(C(=O)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H33NO/c1-10-15(6,11-2)12-16(7,14(3,4)5)13(18)17(8)9/h10-12H2,1-9H3 |
| InChIKey | KZUOENWTFKYMQP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |