C23H29F3N4O2S — CID 142378951
4-methylmorpholine;1-(4-pyrrolidin-1-ylsulfanylphenyl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 142378951) has the molecular formula C23H29F3N4O2S and a molecular weight of 482.57 g/mol. Its IUPAC name is 4-methylmorpholine;1-(4-pyrrolidin-1-ylsulfanylphenyl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 4-methylmorpholine;1-(4-pyrrolidin-1-ylsulfanylphenyl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 142378951 |
| Molecular Formula | C23H29F3N4O2S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 4-methylmorpholine;1-(4-pyrrolidin-1-ylsulfanylphenyl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CN1CCOCC1.O=C(Nc1ccc(SN2CCCC2)cc1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H18F3N3OS.C5H11NO/c19-18(20,21)13-3-5-14(6-4-13)22-17(25)23-15-7-9-16(10-8-15)26-24-11-1-2-12-24;1-6-2-4-7-5-3-6/h3-10H,1-2,11-12H2,(H2,22,23,25);2-5H2,1H3 |
| InChIKey | ONGDZNKPXHXZPP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|