C16H20FN3OS — CID 142379221
N,N-dimethylformamide;4-(5-ethynyl-2-fluorophenyl)-6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 142379221) has the molecular formula C16H20FN3OS and a molecular weight of 321.42 g/mol. Its IUPAC name is N,N-dimethylformamide;4-(5-ethynyl-2-fluorophenyl)-6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | N,N-dimethylformamide;4-(5-ethynyl-2-fluorophenyl)-6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 142379221 |
| Molecular Formula | C16H20FN3OS |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N,N-dimethylformamide;4-(5-ethynyl-2-fluorophenyl)-6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | C#Cc1ccc(F)c(C2CC(C)SC(N)=N2)c1.CN(C)C=O |
| InChI | InChI=1S/C13H13FN2S.C3H7NO/c1-3-9-4-5-11(14)10(7-9)12-6-8(2)17-13(15)16-12;1-4(2)3-5/h1,4-5,7-8,12H,6H2,2H3,(H2,15,16);3H,1-2H3 |
| InChIKey | QDSMCYQIUAVBRZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|