C16H16F2IN3S2 — CID 142379222
acetonitrile;2-[3-(3-amino-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl)-4-fluorophenyl]ethynyl thiohypoiodite;fluoromethane (PubChem CID 142379222) has the molecular formula C16H16F2IN3S2 and a molecular weight of 479.36 g/mol. Its IUPAC name is acetonitrile;2-[3-(3-amino-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl)-4-fluorophenyl]ethynyl thiohypoiodite;fluoromethane.
| Compound Name | acetonitrile;2-[3-(3-amino-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl)-4-fluorophenyl]ethynyl thiohypoiodite;fluoromethane |
|---|---|
| PubChem CID | 142379222 |
| Molecular Formula | C16H16F2IN3S2 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.98 |
| IUPAC Name | acetonitrile;2-[3-(3-amino-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl)-4-fluorophenyl]ethynyl thiohypoiodite;fluoromethane |
| SMILES | CC#N.CF.NC1=NC(c2cc(C#CSI)ccc2F)C2CC2S1 |
| InChI | InChI=1S/C13H10FIN2S2.C2H3N.CH3F/c14-10-2-1-7(3-4-18-15)5-8(10)12-9-6-11(9)19-13(16)17-12;1-2-3;1-2/h1-2,5,9,11-12H,6H2,(H2,16,17);1H3;1H3 |
| InChIKey | UWMYQPYUPZMBCY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|