About 4-methylnonane;N-methyl-N-propylpentan-1-amine
4-methylnonane;N-methyl-N-propylpentan-1-amine (PubChem CID 142379578) has the molecular formula C19H43N
and a molecular weight of 285.56 g/mol. Its IUPAC name is 4-methylnonane;N-methyl-N-propylpentan-1-amine.
Molecular Properties
| Compound Name | 4-methylnonane;N-methyl-N-propylpentan-1-amine |
| PubChem CID | 142379578 |
| Molecular Formula | C19H43N |
| Molecular Weight | 285.56 g/mol |
| Exact Mass | 285.34 |
| IUPAC Name | 4-methylnonane;N-methyl-N-propylpentan-1-amine |
| SMILES | CCCCCC(C)CCC.CCCCCN(C)CCC |
| InChI | InChI=1S/C10H22.C9H21N/c2*1-4-6-7-9-10(3)8-5-2/h10H,4-9H2,1-3H3;4-9H2,1-3H3 |
| InChIKey | DULLTIALHISQCB-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.56 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methylnonane;N-methyl-N-propylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylnonane;N-methyl-N-propylpentan-1-amine?
The IUPAC name of 4-methylnonane;N-methyl-N-propylpentan-1-amine (CID 142379578) is 4-methylnonane;N-methyl-N-propylpentan-1-amine.
What is the SMILES notation for 4-methylnonane;N-methyl-N-propylpentan-1-amine?
The canonical SMILES for 4-methylnonane;N-methyl-N-propylpentan-1-amine is CCCCCC(C)CCC.CCCCCN(C)CCC.
What is the InChIKey of 4-methylnonane;N-methyl-N-propylpentan-1-amine?
The InChIKey is DULLTIALHISQCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22.C9H21N/c2*1-4-6-7-9-10(3)8-5-2/h10H,4-9H2,1-3H3;4-9H2,1-3H3.
What are the key properties of 4-methylnonane;N-methyl-N-propylpentan-1-amine?
4-methylnonane;N-methyl-N-propylpentan-1-amine has a molecular weight of 285.56 g/mol, XLogP of 6.52, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylnonane;N-methyl-N-propylpentan-1-amine is sourced from PubChem (CID 142379578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).