C38H42O7 — CID 14237997
(2R,3R,4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4,5-tetrakis(phenylmethoxy)pentanal (PubChem CID 14237997) has the molecular formula C38H42O7 and a molecular weight of 610.75 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4,5-tetrakis(phenylmethoxy)pentanal.
| Compound Name | (2R,3R,4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4,5-tetrakis(phenylmethoxy)pentanal |
|---|---|
| PubChem CID | 14237997 |
| Molecular Formula | C38H42O7 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | (2R,3R,4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4,5-tetrakis(phenylmethoxy)pentanal |
| SMILES | CC1(C)OC[C@H]([C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](C=O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C38H42O7/c1-38(2)44-28-34(45-38)36(42-26-31-19-11-5-12-20-31)37(43-27-32-21-13-6-14-22-32)35(41-25-30-17-9-4-10-18-30)33(23-39)40-24-29-15-7-3-8-16-29/h3-23,33-37H,24-28H2,1-2H3/t33-,34+,35-,36+,37-/m0/s1 |
| InChIKey | DJRFNILXVNZMBP-JALLVGJNSA-N |
| XLogP | 6.68 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|