C25H31NO4S — CID 142380254
6-[4-ethyl-N-(oxetan-3-yl)anilino]sulfanyl-2-(oxan-4-yl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 142380254) has the molecular formula C25H31NO4S and a molecular weight of 441.59 g/mol. Its IUPAC name is 6-[4-ethyl-N-(oxetan-3-yl)anilino]sulfanyl-2-(oxan-4-yl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 6-[4-ethyl-N-(oxetan-3-yl)anilino]sulfanyl-2-(oxan-4-yl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 142380254 |
| Molecular Formula | C25H31NO4S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 6-[4-ethyl-N-(oxetan-3-yl)anilino]sulfanyl-2-(oxan-4-yl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CCc1ccc(N(Sc2ccc3c(c2)C(O)CC(C2CCOCC2)O3)C2COC2)cc1 |
| InChI | InChI=1S/C25H31NO4S/c1-2-17-3-5-19(6-4-17)26(20-15-29-16-20)31-21-7-8-24-22(13-21)23(27)14-25(30-24)18-9-11-28-12-10-18/h3-8,13,18,20,23,25,27H,2,9-12,14-16H2,1H3 |
| InChIKey | GBWYBWZIVVTPIB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|