About (2Z)-2-ethylidenepyridin-1-amine;prop-1-yne
(2Z)-2-ethylidenepyridin-1-amine;prop-1-yne (PubChem CID 142384573) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is (2Z)-2-ethylidenepyridin-1-amine;prop-1-yne.
Molecular Properties
| Compound Name | (2Z)-2-ethylidenepyridin-1-amine;prop-1-yne |
| PubChem CID | 142384573 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (2Z)-2-ethylidenepyridin-1-amine;prop-1-yne |
| SMILES | C#CC.C/C=C1/C=CC=CN1N |
| InChI | InChI=1S/C7H10N2.C3H4/c1-2-7-5-3-4-6-9(7)8;1-3-2/h2-6H,8H2,1H3;1H,2H3/b7-2-; |
| InChIKey | DSZJZSCEGABWDY-YMWUIOJXSA-N |
| XLogP | 1.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-ethylidenepyridin-1-amine;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-ethylidenepyridin-1-amine;prop-1-yne?
The IUPAC name of (2Z)-2-ethylidenepyridin-1-amine;prop-1-yne (CID 142384573) is (2Z)-2-ethylidenepyridin-1-amine;prop-1-yne.
What is the SMILES notation for (2Z)-2-ethylidenepyridin-1-amine;prop-1-yne?
The canonical SMILES for (2Z)-2-ethylidenepyridin-1-amine;prop-1-yne is C#CC.C/C=C1/C=CC=CN1N.
What is the InChIKey of (2Z)-2-ethylidenepyridin-1-amine;prop-1-yne?
The InChIKey is DSZJZSCEGABWDY-YMWUIOJXSA-N. The full InChI is InChI=1S/C7H10N2.C3H4/c1-2-7-5-3-4-6-9(7)8;1-3-2/h2-6H,8H2,1H3;1H,2H3/b7-2-;.
What are the key properties of (2Z)-2-ethylidenepyridin-1-amine;prop-1-yne?
(2Z)-2-ethylidenepyridin-1-amine;prop-1-yne has a molecular weight of 162.24 g/mol, XLogP of 1.79, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-ethylidenepyridin-1-amine;prop-1-yne is sourced from PubChem (CID 142384573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).