C14H22 — CID 144982541
(3Z,4Z)-3,4-di(ethylidene)cyclopentene;ethane;prop-1-yne (PubChem CID 144982541) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (3Z,4Z)-3,4-di(ethylidene)cyclopentene;ethane;prop-1-yne.
| Compound Name | (3Z,4Z)-3,4-di(ethylidene)cyclopentene;ethane;prop-1-yne |
|---|---|
| PubChem CID | 144982541 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (3Z,4Z)-3,4-di(ethylidene)cyclopentene;ethane;prop-1-yne |
| SMILES | C#CC.C/C=C1/C=CC/C1=C/C.CC |
| InChI | InChI=1S/C9H12.C3H4.C2H6/c1-3-8-6-5-7-9(8)4-2;1-3-2;1-2/h3-6H,7H2,1-2H3;1H,2H3;1-2H3/b8-3-,9-4-;; |
| InChIKey | KTVDFWUKDMHCTR-DKKFFLFYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|