C13H24O2 — CID 143106531
ethane;(5Z,6E)-5-ethylidene-6-propylidene-2H-pyran;methanol (PubChem CID 143106531) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is ethane;(5Z,6E)-5-ethylidene-6-propylidene-2H-pyran;methanol.
| Compound Name | ethane;(5Z,6E)-5-ethylidene-6-propylidene-2H-pyran;methanol |
|---|---|
| PubChem CID | 143106531 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | ethane;(5Z,6E)-5-ethylidene-6-propylidene-2H-pyran;methanol |
| SMILES | C/C=C1/C=CCO/C1=C/CC.CC.CO |
| InChI | InChI=1S/C10H14O.C2H6.CH4O/c1-3-6-10-9(4-2)7-5-8-11-10;2*1-2/h4-7H,3,8H2,1-2H3;1-2H3;2H,1H3/b9-4-,10-6+;; |
| InChIKey | WMNANRQMNNKLJZ-IUMVZCIESA-N |
| XLogP | 3.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |