C8H12O2 — CID 88980689
(4E,5E)-4-ethylidene-5-propylidene-1,3-dioxolane (PubChem CID 88980689) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (4E,5E)-4-ethylidene-5-propylidene-1,3-dioxolane.
| Compound Name | (4E,5E)-4-ethylidene-5-propylidene-1,3-dioxolane |
|---|---|
| PubChem CID | 88980689 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (4E,5E)-4-ethylidene-5-propylidene-1,3-dioxolane |
| SMILES | C/C=C1/OCO/C1=C/CC |
| InChI | InChI=1S/C8H12O2/c1-3-5-8-7(4-2)9-6-10-8/h4-5H,3,6H2,1-2H3/b7-4+,8-5+ |
| InChIKey | KHTZIFLLZWXDDF-NSLJXJERSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |