C11H21NO2 — CID 160974653
(4E,5E)-4,5-di(ethylidene)-1,3-dioxolane;methanamine;prop-1-ene (PubChem CID 160974653) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (4E,5E)-4,5-di(ethylidene)-1,3-dioxolane;methanamine;prop-1-ene.
| Compound Name | (4E,5E)-4,5-di(ethylidene)-1,3-dioxolane;methanamine;prop-1-ene |
|---|---|
| PubChem CID | 160974653 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (4E,5E)-4,5-di(ethylidene)-1,3-dioxolane;methanamine;prop-1-ene |
| SMILES | C/C=C1/OCO/C1=C/C.C=CC.CN |
| InChI | InChI=1S/C7H10O2.C3H6.CH5N/c1-3-6-7(4-2)9-5-8-6;1-3-2;1-2/h3-4H,5H2,1-2H3;3H,1H2,2H3;2H2,1H3/b6-3+,7-4+;; |
| InChIKey | SYRWCPRZCXFZFE-JPEBYSQZSA-N |
| XLogP | 2.57 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|