C7H10O2 — CID 144611337
(2E)-2-ethylidene-3-methylidene-1,4-dioxane (PubChem CID 144611337) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is (2E)-2-ethylidene-3-methylidene-1,4-dioxane.
| Compound Name | (2E)-2-ethylidene-3-methylidene-1,4-dioxane |
|---|---|
| PubChem CID | 144611337 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | (2E)-2-ethylidene-3-methylidene-1,4-dioxane |
| SMILES | C=C1OCCO/C1=C/C |
| InChI | InChI=1S/C7H10O2/c1-3-7-6(2)8-4-5-9-7/h3H,2,4-5H2,1H3/b7-3+ |
| InChIKey | XGPYWTMEVKGVQS-XVNBXDOJSA-N |
| XLogP | 1.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |