C8H12OS — CID 123863713
2,3-di(ethylidene)-1,4-oxathiane (PubChem CID 123863713) has the molecular formula C8H12OS and a molecular weight of 156.25 g/mol. Its IUPAC name is 2,3-di(ethylidene)-1,4-oxathiane.
| Compound Name | 2,3-di(ethylidene)-1,4-oxathiane |
|---|---|
| PubChem CID | 123863713 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 2,3-di(ethylidene)-1,4-oxathiane |
| SMILES | CC=C1OCCSC1=CC |
| InChI | InChI=1S/C8H12OS/c1-3-7-8(4-2)10-6-5-9-7/h3-4H,5-6H2,1-2H3 |
| InChIKey | YGPAZKVBIHTWGU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |