C11H16O — CID 89289028
(2Z,3Z)-3-[(Z)-but-2-enylidene]-2-ethylideneoxane (PubChem CID 89289028) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (2Z,3Z)-3-[(Z)-but-2-enylidene]-2-ethylideneoxane.
| Compound Name | (2Z,3Z)-3-[(Z)-but-2-enylidene]-2-ethylideneoxane |
|---|---|
| PubChem CID | 89289028 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (2Z,3Z)-3-[(Z)-but-2-enylidene]-2-ethylideneoxane |
| SMILES | C/C=C\C=C1\CCCO\C1=C/C |
| InChI | InChI=1S/C11H16O/c1-3-5-7-10-8-6-9-12-11(10)4-2/h3-5,7H,6,8-9H2,1-2H3/b5-3-,10-7-,11-4- |
| InChIKey | HQYYHHNWQUPKOU-IGCUISKOSA-N |
| XLogP | 3.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |