C10H14O2 — CID 146396950
5,6-bis[(Z)-prop-1-enyl]-2,3-dihydro-1,4-dioxine (PubChem CID 146396950) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 5,6-bis[(Z)-prop-1-enyl]-2,3-dihydro-1,4-dioxine.
| Compound Name | 5,6-bis[(Z)-prop-1-enyl]-2,3-dihydro-1,4-dioxine |
|---|---|
| PubChem CID | 146396950 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 5,6-bis[(Z)-prop-1-enyl]-2,3-dihydro-1,4-dioxine |
| SMILES | C/C=C\C1=C(/C=C\C)OCCO1 |
| InChI | InChI=1S/C10H14O2/c1-3-5-9-10(6-4-2)12-8-7-11-9/h3-6H,7-8H2,1-2H3/b5-3-,6-4- |
| InChIKey | KSWKHSYVNIZGTG-GLIMQPGKSA-N |
| XLogP | 2.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |