About 4-(4,4-dimethylpent-1-enyl)-5-prop-1-enyl-1,3-dioxole
4-(4,4-dimethylpent-1-enyl)-5-prop-1-enyl-1,3-dioxole (PubChem CID 91221875) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-(4,4-dimethylpent-1-enyl)-5-prop-1-enyl-1,3-dioxole.
Analyze 4-(4,4-dimethylpent-1-enyl)-5-prop-1-enyl-1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethylpent-1-enyl)-5-prop-1-enyl-1,3-dioxole?
The IUPAC name of 4-(4,4-dimethylpent-1-enyl)-5-prop-1-enyl-1,3-dioxole (CID 91221875) is 4-(4,4-dimethylpent-1-enyl)-5-prop-1-enyl-1,3-dioxole.
What is the SMILES notation for 4-(4,4-dimethylpent-1-enyl)-5-prop-1-enyl-1,3-dioxole?
The canonical SMILES for 4-(4,4-dimethylpent-1-enyl)-5-prop-1-enyl-1,3-dioxole is CC=CC1=C(C=CCC(C)(C)C)OCO1.
What is the InChIKey of 4-(4,4-dimethylpent-1-enyl)-5-prop-1-enyl-1,3-dioxole?
The InChIKey is KYQCGMQYNTUZLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c1-5-7-11-12(15-10-14-11)8-6-9-13(2,3)4/h5-8H,9-10H2,1-4H3.
What are the key properties of 4-(4,4-dimethylpent-1-enyl)-5-prop-1-enyl-1,3-dioxole?
4-(4,4-dimethylpent-1-enyl)-5-prop-1-enyl-1,3-dioxole has a molecular weight of 208.30 g/mol, XLogP of 3.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethylpent-1-enyl)-5-prop-1-enyl-1,3-dioxole is sourced from PubChem (CID 91221875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).