C9H12O2 — CID 123458039
2-but-2-enylidene-3-methylidene-1,4-dioxane (PubChem CID 123458039) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 2-but-2-enylidene-3-methylidene-1,4-dioxane.
| Compound Name | 2-but-2-enylidene-3-methylidene-1,4-dioxane |
|---|---|
| PubChem CID | 123458039 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 2-but-2-enylidene-3-methylidene-1,4-dioxane |
| SMILES | C=C1OCCOC1=CC=CC |
| InChI | InChI=1S/C9H12O2/c1-3-4-5-9-8(2)10-6-7-11-9/h3-5H,2,6-7H2,1H3 |
| InChIKey | KDDMHJMBUDJZBV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |