C60H49N5 — CID 142385296
(Z)-but-2-ene;cyclohexa-1,3-diene;2,4-diphenyl-6-[3-[6-(9-phenyl-9-pyridin-4-ylfluoren-4-yl)-2-pyridinyl]phenyl]-1,3,5-triazine (PubChem CID 142385296) has the molecular formula C60H49N5 and a molecular weight of 840.09 g/mol. Its IUPAC name is (Z)-but-2-ene;cyclohexa-1,3-diene;2,4-diphenyl-6-[3-[6-(9-phenyl-9-pyridin-4-ylfluoren-4-yl)-2-pyridinyl]phenyl]-1,3,5-triazine.
| Compound Name | (Z)-but-2-ene;cyclohexa-1,3-diene;2,4-diphenyl-6-[3-[6-(9-phenyl-9-pyridin-4-ylfluoren-4-yl)-2-pyridinyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 142385296 |
| Molecular Formula | C60H49N5 |
| Molecular Weight | 840.09 g/mol |
| Exact Mass | 839.40 |
| IUPAC Name | (Z)-but-2-ene;cyclohexa-1,3-diene;2,4-diphenyl-6-[3-[6-(9-phenyl-9-pyridin-4-ylfluoren-4-yl)-2-pyridinyl]phenyl]-1,3,5-triazine |
| SMILES | C/C=C\C.C1=CCCC=C1.c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cccc(-c5cccc6c5-c5ccccc5C6(c5ccccc5)c5ccncc5)n4)c3)n2)cc1 |
| InChI | InChI=1S/C50H33N5.C6H8.C4H8/c1-4-15-34(16-5-1)47-53-48(35-17-6-2-7-18-35)55-49(54-47)37-20-12-19-36(33-37)44-27-14-28-45(52-44)41-24-13-26-43-46(41)40-23-10-11-25-42(40)50(43,38-21-8-3-9-22-38)39-29-31-51-32-30-39;1-2-4-6-5-3-1;1-3-4-2/h1-33H;1-4H,5-6H2;3-4H,1-2H3/b;;4-3- |
| InChIKey | NCHFWXMRXXDYQH-PWIAZYAQSA-N |
| XLogP | 14.83 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.09 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|