C34H47F2N3O3S — CID 142387479
N-(3-amino-4-methylcyclohexylidene)-3-(4-butoxyphenyl)-2-[[4-(cyclohexylmethoxy)phenyl]sulfanyl-methylamino]-3,3-difluoropropanamide (PubChem CID 142387479) has the molecular formula C34H47F2N3O3S and a molecular weight of 615.83 g/mol. Its IUPAC name is N-(3-amino-4-methylcyclohexylidene)-3-(4-butoxyphenyl)-2-[[4-(cyclohexylmethoxy)phenyl]sulfanyl-methylamino]-3,3-difluoropropanamide.
| Compound Name | N-(3-amino-4-methylcyclohexylidene)-3-(4-butoxyphenyl)-2-[[4-(cyclohexylmethoxy)phenyl]sulfanyl-methylamino]-3,3-difluoropropanamide |
|---|---|
| PubChem CID | 142387479 |
| Molecular Formula | C34H47F2N3O3S |
| Molecular Weight | 615.83 g/mol |
| Exact Mass | 615.33 |
| IUPAC Name | N-(3-amino-4-methylcyclohexylidene)-3-(4-butoxyphenyl)-2-[[4-(cyclohexylmethoxy)phenyl]sulfanyl-methylamino]-3,3-difluoropropanamide |
| SMILES | CCCCOc1ccc(C(F)(F)C(C(=O)/N=C2\CCC(C)C(N)C2)N(C)Sc2ccc(OCC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C34H47F2N3O3S/c1-4-5-21-41-28-15-12-26(13-16-28)34(35,36)32(33(40)38-27-14-11-24(2)31(37)22-27)39(3)43-30-19-17-29(18-20-30)42-23-25-9-7-6-8-10-25/h12-13,15-20,24-25,31-32H,4-11,14,21-23,37H2,1-3H3/b38-27+ |
| InChIKey | HAXDYBMLJKXEDR-ACPRRRJJSA-N |
| XLogP | 8.04 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.83 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|