C14H19F2NO3 — CID 153445435
3-(4-butoxyphenyl)-3,3-difluoro-2-(methylamino)propanoic acid (PubChem CID 153445435) has the molecular formula C14H19F2NO3 and a molecular weight of 287.31 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-3,3-difluoro-2-(methylamino)propanoic acid.
| Compound Name | 3-(4-butoxyphenyl)-3,3-difluoro-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 153445435 |
| Molecular Formula | C14H19F2NO3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3-(4-butoxyphenyl)-3,3-difluoro-2-(methylamino)propanoic acid |
| SMILES | CCCCOc1ccc(C(F)(F)C(NC)C(=O)O)cc1 |
| InChI | InChI=1S/C14H19F2NO3/c1-3-4-9-20-11-7-5-10(6-8-11)14(15,16)12(17-2)13(18)19/h5-8,12,17H,3-4,9H2,1-2H3,(H,18,19) |
| InChIKey | NKEAYENJYHGPLM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|