C13H17BrMgO2 — CID 14238760
magnesium;2,5,5-trimethyl-2-phenyl-1,3-dioxane;bromide (PubChem CID 14238760) has the molecular formula C13H17BrMgO2 and a molecular weight of 309.49 g/mol. Its IUPAC name is magnesium;2,5,5-trimethyl-2-phenyl-1,3-dioxane;bromide.
| Compound Name | magnesium;2,5,5-trimethyl-2-phenyl-1,3-dioxane;bromide |
|---|---|
| PubChem CID | 14238760 |
| Molecular Formula | C13H17BrMgO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | magnesium;2,5,5-trimethyl-2-phenyl-1,3-dioxane;bromide |
| SMILES | CC1(C)COC(C)(c2cc[c-]cc2)OC1.[Br-].[Mg+2] |
| InChI | InChI=1S/C13H17O2.BrH.Mg/c1-12(2)9-14-13(3,15-10-12)11-7-5-4-6-8-11;;/h5-8H,9-10H2,1-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | OGNWOLVFPDPLKH-UHFFFAOYSA-M |
| XLogP | -0.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|