C27H27ClFN3O2S — CID 142388241
4-[5-chloro-3-[(2S,6S)-2,6-dimethyl-4-(prop-2-enoxymethyl)piperazin-1-yl]-7-fluoro-2,1-benzothiazol-6-yl]naphthalen-2-ol (PubChem CID 142388241) has the molecular formula C27H27ClFN3O2S and a molecular weight of 512.05 g/mol. Its IUPAC name is 4-[5-chloro-3-[(2S,6S)-2,6-dimethyl-4-(prop-2-enoxymethyl)piperazin-1-yl]-7-fluoro-2,1-benzothiazol-6-yl]naphthalen-2-ol.
| Compound Name | 4-[5-chloro-3-[(2S,6S)-2,6-dimethyl-4-(prop-2-enoxymethyl)piperazin-1-yl]-7-fluoro-2,1-benzothiazol-6-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 142388241 |
| Molecular Formula | C27H27ClFN3O2S |
| Molecular Weight | 512.05 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 4-[5-chloro-3-[(2S,6S)-2,6-dimethyl-4-(prop-2-enoxymethyl)piperazin-1-yl]-7-fluoro-2,1-benzothiazol-6-yl]naphthalen-2-ol |
| SMILES | C=CCOCN1C[C@H](C)N(c2snc3c(F)c(-c4cc(O)cc5ccccc45)c(Cl)cc23)[C@@H](C)C1 |
| InChI | InChI=1S/C27H27ClFN3O2S/c1-4-9-34-15-31-13-16(2)32(17(3)14-31)27-22-12-23(28)24(25(29)26(22)30-35-27)21-11-19(33)10-18-7-5-6-8-20(18)21/h4-8,10-12,16-17,33H,1,9,13-15H2,2-3H3/t16-,17-/m0/s1 |
| InChIKey | XDMHRCPMWZDXNK-IRXDYDNUSA-N |
| XLogP | 6.67 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.05 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|