C30H34ClFN4O2 — CID 153177586
4-[6-chloro-2-[3-(dimethylamino)propoxy]-4-[(2S,5S)-2,5-dimethylpiperidin-1-yl]-8-fluoroquinazolin-7-yl]naphthalen-2-ol (PubChem CID 153177586) has the molecular formula C30H34ClFN4O2 and a molecular weight of 537.08 g/mol. Its IUPAC name is 4-[6-chloro-2-[3-(dimethylamino)propoxy]-4-[(2S,5S)-2,5-dimethylpiperidin-1-yl]-8-fluoroquinazolin-7-yl]naphthalen-2-ol.
| Compound Name | 4-[6-chloro-2-[3-(dimethylamino)propoxy]-4-[(2S,5S)-2,5-dimethylpiperidin-1-yl]-8-fluoroquinazolin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 153177586 |
| Molecular Formula | C30H34ClFN4O2 |
| Molecular Weight | 537.08 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | 4-[6-chloro-2-[3-(dimethylamino)propoxy]-4-[(2S,5S)-2,5-dimethylpiperidin-1-yl]-8-fluoroquinazolin-7-yl]naphthalen-2-ol |
| SMILES | C[C@H]1CC[C@H](C)N(c2nc(OCCCN(C)C)nc3c(F)c(-c4cc(O)cc5ccccc45)c(Cl)cc23)C1 |
| InChI | InChI=1S/C30H34ClFN4O2/c1-18-10-11-19(2)36(17-18)29-24-16-25(31)26(23-15-21(37)14-20-8-5-6-9-22(20)23)27(32)28(24)33-30(34-29)38-13-7-12-35(3)4/h5-6,8-9,14-16,18-19,37H,7,10-13,17H2,1-4H3/t18-,19-/m0/s1 |
| InChIKey | WFMWCMOMDULSNK-OALUTQOASA-N |
| XLogP | 6.90 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.08 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|