C28H31ClFN5O — CID 145378335
3-[6-chloro-8-fluoro-4-(3-methylpiperazin-1-yl)-7-naphthalen-1-ylquinazolin-2-yl]oxy-N,N-dimethylpropan-1-amine (PubChem CID 145378335) has the molecular formula C28H31ClFN5O and a molecular weight of 508.04 g/mol. Its IUPAC name is 3-[6-chloro-8-fluoro-4-(3-methylpiperazin-1-yl)-7-naphthalen-1-ylquinazolin-2-yl]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[6-chloro-8-fluoro-4-(3-methylpiperazin-1-yl)-7-naphthalen-1-ylquinazolin-2-yl]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 145378335 |
| Molecular Formula | C28H31ClFN5O |
| Molecular Weight | 508.04 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 3-[6-chloro-8-fluoro-4-(3-methylpiperazin-1-yl)-7-naphthalen-1-ylquinazolin-2-yl]oxy-N,N-dimethylpropan-1-amine |
| SMILES | CC1CN(c2nc(OCCCN(C)C)nc3c(F)c(-c4cccc5ccccc45)c(Cl)cc23)CCN1 |
| InChI | InChI=1S/C28H31ClFN5O/c1-18-17-35(14-12-31-18)27-22-16-23(29)24(21-11-6-9-19-8-4-5-10-20(19)21)25(30)26(22)32-28(33-27)36-15-7-13-34(2)3/h4-6,8-11,16,18,31H,7,12-15,17H2,1-3H3 |
| InChIKey | KSQMERFAAMKHGI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.04 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|