C33H37ClFN5O2 — CID 170092218
4-[6-chloro-4-(3,8-diazabicyclo[4.2.1]nonan-3-yl)-8-fluoro-2-(3-piperidin-1-ylpropoxy)quinazolin-7-yl]naphthalen-2-ol (PubChem CID 170092218) has the molecular formula C33H37ClFN5O2 and a molecular weight of 590.14 g/mol. Its IUPAC name is 4-[6-chloro-4-(3,8-diazabicyclo[4.2.1]nonan-3-yl)-8-fluoro-2-(3-piperidin-1-ylpropoxy)quinazolin-7-yl]naphthalen-2-ol.
| Compound Name | 4-[6-chloro-4-(3,8-diazabicyclo[4.2.1]nonan-3-yl)-8-fluoro-2-(3-piperidin-1-ylpropoxy)quinazolin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 170092218 |
| Molecular Formula | C33H37ClFN5O2 |
| Molecular Weight | 590.14 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | 4-[6-chloro-4-(3,8-diazabicyclo[4.2.1]nonan-3-yl)-8-fluoro-2-(3-piperidin-1-ylpropoxy)quinazolin-7-yl]naphthalen-2-ol |
| SMILES | Oc1cc(-c2c(Cl)cc3c(N4CCC5CNC(C5)C4)nc(OCCCN4CCCCC4)nc3c2F)c2ccccc2c1 |
| InChI | InChI=1S/C33H37ClFN5O2/c34-28-18-27-31(30(35)29(28)26-17-24(41)16-22-7-2-3-8-25(22)26)37-33(42-14-6-12-39-10-4-1-5-11-39)38-32(27)40-13-9-21-15-23(20-40)36-19-21/h2-3,7-8,16-18,21,23,36,41H,1,4-6,9-15,19-20H2 |
| InChIKey | HZYQZRYOJXXPLG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.14 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|