C30H34ClFN6O — CID 170087430
4-[6-chloro-4-(3,8-diazabicyclo[4.2.1]nonan-3-yl)-2-[3-(dimethylamino)propylamino]-8-fluoroquinazolin-7-yl]naphthalen-2-ol (PubChem CID 170087430) has the molecular formula C30H34ClFN6O and a molecular weight of 549.09 g/mol. Its IUPAC name is 4-[6-chloro-4-(3,8-diazabicyclo[4.2.1]nonan-3-yl)-2-[3-(dimethylamino)propylamino]-8-fluoroquinazolin-7-yl]naphthalen-2-ol.
| Compound Name | 4-[6-chloro-4-(3,8-diazabicyclo[4.2.1]nonan-3-yl)-2-[3-(dimethylamino)propylamino]-8-fluoroquinazolin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 170087430 |
| Molecular Formula | C30H34ClFN6O |
| Molecular Weight | 549.09 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 4-[6-chloro-4-(3,8-diazabicyclo[4.2.1]nonan-3-yl)-2-[3-(dimethylamino)propylamino]-8-fluoroquinazolin-7-yl]naphthalen-2-ol |
| SMILES | CN(C)CCCNc1nc(N2CCC3CNC(C3)C2)c2cc(Cl)c(-c3cc(O)cc4ccccc34)c(F)c2n1 |
| InChI | InChI=1S/C30H34ClFN6O/c1-37(2)10-5-9-33-30-35-28-24(29(36-30)38-11-8-18-12-20(17-38)34-16-18)15-25(31)26(27(28)32)23-14-21(39)13-19-6-3-4-7-22(19)23/h3-4,6-7,13-15,18,20,34,39H,5,8-12,16-17H2,1-2H3,(H,33,35,36) |
| InChIKey | IRPPZPCCOHMTNI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.09 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|