C26H25ClFN3OS — CID 146289771
4-[5-chloro-3-[(2S,6S)-2,6-dimethyl-4-prop-2-enylpiperazin-1-yl]-7-fluoro-2,1-benzothiazol-6-yl]naphthalen-2-ol (PubChem CID 146289771) has the molecular formula C26H25ClFN3OS and a molecular weight of 482.02 g/mol. Its IUPAC name is 4-[5-chloro-3-[(2S,6S)-2,6-dimethyl-4-prop-2-enylpiperazin-1-yl]-7-fluoro-2,1-benzothiazol-6-yl]naphthalen-2-ol.
| Compound Name | 4-[5-chloro-3-[(2S,6S)-2,6-dimethyl-4-prop-2-enylpiperazin-1-yl]-7-fluoro-2,1-benzothiazol-6-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 146289771 |
| Molecular Formula | C26H25ClFN3OS |
| Molecular Weight | 482.02 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 4-[5-chloro-3-[(2S,6S)-2,6-dimethyl-4-prop-2-enylpiperazin-1-yl]-7-fluoro-2,1-benzothiazol-6-yl]naphthalen-2-ol |
| SMILES | C=CCN1C[C@H](C)N(c2snc3c(F)c(-c4cc(O)cc5ccccc45)c(Cl)cc23)[C@@H](C)C1 |
| InChI | InChI=1S/C26H25ClFN3OS/c1-4-9-30-13-15(2)31(16(3)14-30)26-21-12-22(27)23(24(28)25(21)29-33-26)20-11-18(32)10-17-7-5-6-8-19(17)20/h4-8,10-12,15-16,32H,1,9,13-14H2,2-3H3/t15-,16-/m0/s1 |
| InChIKey | FLJCGFRVMXOEDO-HOTGVXAUSA-N |
| XLogP | 6.70 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.02 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|