C25H48N4O — CID 142389273
N'-cyclohexa-1,3-dien-1-yl-N,N'-dimethylethane-1,2-diamine;ethane;N'-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 142389273) has the molecular formula C25H48N4O and a molecular weight of 420.69 g/mol. Its IUPAC name is N'-cyclohexa-1,3-dien-1-yl-N,N'-dimethylethane-1,2-diamine;ethane;N'-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-cyclohexa-1,3-dien-1-yl-N,N'-dimethylethane-1,2-diamine;ethane;N'-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 142389273 |
| Molecular Formula | C25H48N4O |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 420.38 |
| IUPAC Name | N'-cyclohexa-1,3-dien-1-yl-N,N'-dimethylethane-1,2-diamine;ethane;N'-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | C=C/C=C\C(=C)OCCCN(C)CCNC.CC.CNCCN(C)C1=CC=CCC1 |
| InChI | InChI=1S/C13H24N2O.C10H18N2.C2H6/c1-5-6-8-13(2)16-12-7-10-15(4)11-9-14-3;1-11-8-9-12(2)10-6-4-3-5-7-10;1-2/h5-6,8,14H,1-2,7,9-12H2,3-4H3;3-4,6,11H,5,7-9H2,1-2H3;1-2H3/b8-6-;; |
| InChIKey | RLGINHFIRFTNBG-OTDBEEGXSA-N |
| XLogP | 4.20 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|