C29H58N4O — CID 142409694
N'-cyclohexa-1,3-dien-1-yl-N,N,N'-trimethylethane-1,2-diamine;ethane;N'-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 142409694) has the molecular formula C29H58N4O and a molecular weight of 478.81 g/mol. Its IUPAC name is N'-cyclohexa-1,3-dien-1-yl-N,N,N'-trimethylethane-1,2-diamine;ethane;N'-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-cyclohexa-1,3-dien-1-yl-N,N,N'-trimethylethane-1,2-diamine;ethane;N'-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 142409694 |
| Molecular Formula | C29H58N4O |
| Molecular Weight | 478.81 g/mol |
| Exact Mass | 478.46 |
| IUPAC Name | N'-cyclohexa-1,3-dien-1-yl-N,N,N'-trimethylethane-1,2-diamine;ethane;N'-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | C=C/C=C\C(=C)OCCCN(C)CCN(C)C.CC.CC.CN(C)CCN(C)C1=CC=CCC1 |
| InChI | InChI=1S/C14H26N2O.C11H20N2.2C2H6/c1-6-7-9-14(2)17-13-8-10-16(5)12-11-15(3)4;1-12(2)9-10-13(3)11-7-5-4-6-8-11;2*1-2/h6-7,9H,1-2,8,10-13H2,3-5H3;4-5,7H,6,8-10H2,1-3H3;2*1-2H3/b9-7-;;; |
| InChIKey | RPSDLLBFAYKOIL-AXXLBGQXSA-N |
| XLogP | 5.91 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.81 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|