C11H16N2O — CID 142389284
ethane;7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one (PubChem CID 142389284) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is ethane;7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one.
| Compound Name | ethane;7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one |
|---|---|
| PubChem CID | 142389284 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | ethane;7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one |
| SMILES | CC.CN1CC2=C(C=CCC=N2)C1=O |
| InChI | InChI=1S/C9H10N2O.C2H6/c1-11-6-8-7(9(11)12)4-2-3-5-10-8;1-2/h2,4-5H,3,6H2,1H3;1-2H3 |
| InChIKey | VRJPRQAQHKQLLR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |