C9H8N2O2 — CID 142123825
7-methyl-3H-pyrrolo[3,4-b]azepine-6,8-dione (PubChem CID 142123825) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 7-methyl-3H-pyrrolo[3,4-b]azepine-6,8-dione.
| Compound Name | 7-methyl-3H-pyrrolo[3,4-b]azepine-6,8-dione |
|---|---|
| PubChem CID | 142123825 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 7-methyl-3H-pyrrolo[3,4-b]azepine-6,8-dione |
| SMILES | CN1C(=O)C2=C(N=CCC=C2)C1=O |
| InChI | InChI=1S/C9H8N2O2/c1-11-8(12)6-4-2-3-5-10-7(6)9(11)13/h2,4-5H,3H2,1H3 |
| InChIKey | FDBYXEIYDDYJST-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|