About azane;3-hydrazinylbenzaldehyde
azane;3-hydrazinylbenzaldehyde (PubChem CID 142389846) has the molecular formula C7H11N3O
and a molecular weight of 153.18 g/mol. Its IUPAC name is azane;3-hydrazinylbenzaldehyde.
Molecular Properties
| Compound Name | azane;3-hydrazinylbenzaldehyde |
| PubChem CID | 142389846 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | azane;3-hydrazinylbenzaldehyde |
| SMILES | N.NNc1cccc(C=O)c1 |
| InChI | InChI=1S/C7H8N2O.H3N/c8-9-7-3-1-2-6(4-7)5-10;/h1-5,9H,8H2;1H3 |
| InChIKey | LOBCEGZPSIURTN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;3-hydrazinylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-hydrazinylbenzaldehyde?
The IUPAC name of azane;3-hydrazinylbenzaldehyde (CID 142389846) is azane;3-hydrazinylbenzaldehyde.
What is the SMILES notation for azane;3-hydrazinylbenzaldehyde?
The canonical SMILES for azane;3-hydrazinylbenzaldehyde is N.NNc1cccc(C=O)c1.
What is the InChIKey of azane;3-hydrazinylbenzaldehyde?
The InChIKey is LOBCEGZPSIURTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.H3N/c8-9-7-3-1-2-6(4-7)5-10;/h1-5,9H,8H2;1H3.
What are the key properties of azane;3-hydrazinylbenzaldehyde?
azane;3-hydrazinylbenzaldehyde has a molecular weight of 153.18 g/mol, XLogP of 0.95, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-hydrazinylbenzaldehyde is sourced from PubChem (CID 142389846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).