C26H25N3O3S — CID 142391673
ethene;methyl 6-[2-(1H-indole-3-carbonyl)-1,3-thiazol-4-yl]pyridine-2-carboxylate;(3Z)-penta-1,3-diene (PubChem CID 142391673) has the molecular formula C26H25N3O3S and a molecular weight of 459.57 g/mol. Its IUPAC name is ethene;methyl 6-[2-(1H-indole-3-carbonyl)-1,3-thiazol-4-yl]pyridine-2-carboxylate;(3Z)-penta-1,3-diene.
| Compound Name | ethene;methyl 6-[2-(1H-indole-3-carbonyl)-1,3-thiazol-4-yl]pyridine-2-carboxylate;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 142391673 |
| Molecular Formula | C26H25N3O3S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | ethene;methyl 6-[2-(1H-indole-3-carbonyl)-1,3-thiazol-4-yl]pyridine-2-carboxylate;(3Z)-penta-1,3-diene |
| SMILES | C=C.C=C/C=C\C.COC(=O)c1cccc(-c2csc(C(=O)c3c[nH]c4ccccc34)n2)n1 |
| InChI | InChI=1S/C19H13N3O3S.C5H8.C2H4/c1-25-19(24)15-8-4-7-14(21-15)16-10-26-18(22-16)17(23)12-9-20-13-6-3-2-5-11(12)13;1-3-5-4-2;1-2/h2-10,20H,1H3;3-5H,1H2,2H3;1-2H2/b;5-4-; |
| InChIKey | LRFGBYRSGRPURN-FXHNQCOHSA-N |
| XLogP | 6.25 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|