C15H21N — CID 142391741
(1Z,3Z)-5-(4-butylphenyl)penta-1,3-dien-1-amine (PubChem CID 142391741) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (1Z,3Z)-5-(4-butylphenyl)penta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-5-(4-butylphenyl)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142391741 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (1Z,3Z)-5-(4-butylphenyl)penta-1,3-dien-1-amine |
| SMILES | CCCCc1ccc(C/C=C\C=C/N)cc1 |
| InChI | InChI=1S/C15H21N/c1-2-3-7-14-9-11-15(12-10-14)8-5-4-6-13-16/h4-6,9-13H,2-3,7-8,16H2,1H3/b5-4-,13-6- |
| InChIKey | SDRDRLCFKOCWPF-YIDBNINZSA-N |
| XLogP | 3.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|