C14H18 — CID 90986104
1-buta-2,3-dienyl-4-butylbenzene (PubChem CID 90986104) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-buta-2,3-dienyl-4-butylbenzene.
| Compound Name | 1-buta-2,3-dienyl-4-butylbenzene |
|---|---|
| PubChem CID | 90986104 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-buta-2,3-dienyl-4-butylbenzene |
| SMILES | C=C=CCc1ccc(CCCC)cc1 |
| InChI | InChI=1S/C14H18/c1-3-5-7-13-9-11-14(12-10-13)8-6-4-2/h5,9-12H,1,4,6-8H2,2H3 |
| InChIKey | XOECGKXTZYJJHY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |