C18H23N3 — CID 142391921
N-methyl-N-[(3-pyrimidin-4-ylphenyl)methyl]cyclohexanamine (PubChem CID 142391921) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is N-methyl-N-[(3-pyrimidin-4-ylphenyl)methyl]cyclohexanamine.
| Compound Name | N-methyl-N-[(3-pyrimidin-4-ylphenyl)methyl]cyclohexanamine |
|---|---|
| PubChem CID | 142391921 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N-methyl-N-[(3-pyrimidin-4-ylphenyl)methyl]cyclohexanamine |
| SMILES | CN(Cc1cccc(-c2ccncn2)c1)C1CCCCC1 |
| InChI | InChI=1S/C18H23N3/c1-21(17-8-3-2-4-9-17)13-15-6-5-7-16(12-15)18-10-11-19-14-20-18/h5-7,10-12,14,17H,2-4,8-9,13H2,1H3 |
| InChIKey | GUWKCCLPHCAGKE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |