C13H18ClNO4 — CID 142392375
chloromethyl 2-[[(3E)-hexa-1,3,5-trien-3-yl]oxycarbonylamino]-3-methylbutanoate (PubChem CID 142392375) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is chloromethyl 2-[[(3E)-hexa-1,3,5-trien-3-yl]oxycarbonylamino]-3-methylbutanoate.
| Compound Name | chloromethyl 2-[[(3E)-hexa-1,3,5-trien-3-yl]oxycarbonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 142392375 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | chloromethyl 2-[[(3E)-hexa-1,3,5-trien-3-yl]oxycarbonylamino]-3-methylbutanoate |
| SMILES | C=C/C=C(\C=C)OC(=O)NC(C(=O)OCCl)C(C)C |
| InChI | InChI=1S/C13H18ClNO4/c1-5-7-10(6-2)19-13(17)15-11(9(3)4)12(16)18-8-14/h5-7,9,11H,1-2,8H2,3-4H3,(H,15,17)/b10-7+ |
| InChIKey | MLNZMUMONHPTIL-JXMROGBWSA-N |
| XLogP | 2.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|