About 6-chloro-1H-indole-3-thiol;2-fluoro-4-(trifluoromethyl)aniline
6-chloro-1H-indole-3-thiol;2-fluoro-4-(trifluoromethyl)aniline (PubChem CID 142393252) has the molecular formula C15H11ClF4N2S
and a molecular weight of 362.78 g/mol. Its IUPAC name is 6-chloro-1H-indole-3-thiol;2-fluoro-4-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 6-chloro-1H-indole-3-thiol;2-fluoro-4-(trifluoromethyl)aniline |
| PubChem CID | 142393252 |
| Molecular Formula | C15H11ClF4N2S |
| Molecular Weight | 362.78 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 6-chloro-1H-indole-3-thiol;2-fluoro-4-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(C(F)(F)F)cc1F.Sc1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C8H6ClNS.C7H5F4N/c9-5-1-2-6-7(3-5)10-4-8(6)11;8-5-3-4(7(9,10)11)1-2-6(5)12/h1-4,10-11H;1-3H,12H2 |
| InChIKey | MPLKWKQEUPXQIY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.78 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1H-indole-3-thiol;2-fluoro-4-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1H-indole-3-thiol;2-fluoro-4-(trifluoromethyl)aniline?
The IUPAC name of 6-chloro-1H-indole-3-thiol;2-fluoro-4-(trifluoromethyl)aniline (CID 142393252) is 6-chloro-1H-indole-3-thiol;2-fluoro-4-(trifluoromethyl)aniline.
What is the SMILES notation for 6-chloro-1H-indole-3-thiol;2-fluoro-4-(trifluoromethyl)aniline?
The canonical SMILES for 6-chloro-1H-indole-3-thiol;2-fluoro-4-(trifluoromethyl)aniline is Nc1ccc(C(F)(F)F)cc1F.Sc1c[nH]c2cc(Cl)ccc12.
What is the InChIKey of 6-chloro-1H-indole-3-thiol;2-fluoro-4-(trifluoromethyl)aniline?
The InChIKey is MPLKWKQEUPXQIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNS.C7H5F4N/c9-5-1-2-6-7(3-5)10-4-8(6)11;8-5-3-4(7(9,10)11)1-2-6(5)12/h1-4,10-11H;1-3H,12H2.
What are the key properties of 6-chloro-1H-indole-3-thiol;2-fluoro-4-(trifluoromethyl)aniline?
6-chloro-1H-indole-3-thiol;2-fluoro-4-(trifluoromethyl)aniline has a molecular weight of 362.78 g/mol, XLogP of 5.54, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1H-indole-3-thiol;2-fluoro-4-(trifluoromethyl)aniline is sourced from PubChem (CID 142393252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).