C18H13F6N3O7S2 — CID 142396865
5-ethylsulfonyl-N-(2,2,2-trifluoroethoxy)-6-[5-(trifluoromethylsulfonyl)-1,3-benzoxazol-2-yl]pyridine-3-carboxamide (PubChem CID 142396865) has the molecular formula C18H13F6N3O7S2 and a molecular weight of 561.44 g/mol. Its IUPAC name is 5-ethylsulfonyl-N-(2,2,2-trifluoroethoxy)-6-[5-(trifluoromethylsulfonyl)-1,3-benzoxazol-2-yl]pyridine-3-carboxamide.
| Compound Name | 5-ethylsulfonyl-N-(2,2,2-trifluoroethoxy)-6-[5-(trifluoromethylsulfonyl)-1,3-benzoxazol-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142396865 |
| Molecular Formula | C18H13F6N3O7S2 |
| Molecular Weight | 561.44 g/mol |
| Exact Mass | 561.01 |
| IUPAC Name | 5-ethylsulfonyl-N-(2,2,2-trifluoroethoxy)-6-[5-(trifluoromethylsulfonyl)-1,3-benzoxazol-2-yl]pyridine-3-carboxamide |
| SMILES | CCS(=O)(=O)c1cc(C(=O)NOCC(F)(F)F)cnc1-c1nc2cc(S(=O)(=O)C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C18H13F6N3O7S2/c1-2-35(29,30)13-5-9(15(28)27-33-8-17(19,20)21)7-25-14(13)16-26-11-6-10(3-4-12(11)34-16)36(31,32)18(22,23)24/h3-7H,2,8H2,1H3,(H,27,28) |
| InChIKey | JTOLVFHIJLXZPO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|