C19H15F6N3O5S3 — CID 146536052
methyl (3Z)-5-ethylsulfonyl-N-(2,2,2-trifluoroethoxy)-6-[5-(trifluoromethoxysulfanyl)-1,3-benzoxazol-2-yl]pyridine-3-carboximidothioate (PubChem CID 146536052) has the molecular formula C19H15F6N3O5S3 and a molecular weight of 575.53 g/mol. Its IUPAC name is methyl (3Z)-5-ethylsulfonyl-N-(2,2,2-trifluoroethoxy)-6-[5-(trifluoromethoxysulfanyl)-1,3-benzoxazol-2-yl]pyridine-3-carboximidothioate.
| Compound Name | methyl (3Z)-5-ethylsulfonyl-N-(2,2,2-trifluoroethoxy)-6-[5-(trifluoromethoxysulfanyl)-1,3-benzoxazol-2-yl]pyridine-3-carboximidothioate |
|---|---|
| PubChem CID | 146536052 |
| Molecular Formula | C19H15F6N3O5S3 |
| Molecular Weight | 575.53 g/mol |
| Exact Mass | 575.01 |
| IUPAC Name | methyl (3Z)-5-ethylsulfonyl-N-(2,2,2-trifluoroethoxy)-6-[5-(trifluoromethoxysulfanyl)-1,3-benzoxazol-2-yl]pyridine-3-carboximidothioate |
| SMILES | CCS(=O)(=O)c1cc(/C(=N/OCC(F)(F)F)SC)cnc1-c1nc2cc(SOC(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C19H15F6N3O5S3/c1-3-36(29,30)14-6-10(17(34-2)28-31-9-18(20,21)22)8-26-15(14)16-27-12-7-11(4-5-13(12)32-16)35-33-19(23,24)25/h4-8H,3,9H2,1-2H3/b28-17- |
| InChIKey | GZRAGYYXVZGMHV-QRQIAZFYSA-N |
| XLogP | 5.83 |
| TPSA | 103.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|