C18H16F3N3O4S — CID 172971144
(E)-1-[5-ethyl-6-(5-methyl-1,3-benzoxazol-2-yl)-3-pyridinyl]-N-(2,2,2-trifluoroethoxy)methanimine;sulfur dioxide (PubChem CID 172971144) has the molecular formula C18H16F3N3O4S and a molecular weight of 427.40 g/mol. Its IUPAC name is (E)-1-[5-ethyl-6-(5-methyl-1,3-benzoxazol-2-yl)-3-pyridinyl]-N-(2,2,2-trifluoroethoxy)methanimine;sulfur dioxide.
| Compound Name | (E)-1-[5-ethyl-6-(5-methyl-1,3-benzoxazol-2-yl)-3-pyridinyl]-N-(2,2,2-trifluoroethoxy)methanimine;sulfur dioxide |
|---|---|
| PubChem CID | 172971144 |
| Molecular Formula | C18H16F3N3O4S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | (E)-1-[5-ethyl-6-(5-methyl-1,3-benzoxazol-2-yl)-3-pyridinyl]-N-(2,2,2-trifluoroethoxy)methanimine;sulfur dioxide |
| SMILES | CCc1cc(/C=N/OCC(F)(F)F)cnc1-c1nc2cc(C)ccc2o1.O=S=O |
| InChI | InChI=1S/C18H16F3N3O2.O2S/c1-3-13-7-12(9-23-25-10-18(19,20)21)8-22-16(13)17-24-14-6-11(2)4-5-15(14)26-17;1-3-2/h4-9H,3,10H2,1-2H3;/b23-9+; |
| InChIKey | OVFUENXWAKCGIR-QCAXIDIISA-N |
| XLogP | 4.00 |
| TPSA | 94.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|